C27H26N2O6S2 — CID 154294586
5-[[4-[5-[4-[(4-oxo-2-sulfanylidene-1,3-oxazolidin-5-ylidene)methyl]phenoxy]heptoxy]phenyl]methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one (PubChem CID 154294586) has the molecular formula C27H26N2O6S2 and a molecular weight of 538.65 g/mol. Its IUPAC name is 5-[[4-[5-[4-[(4-oxo-2-sulfanylidene-1,3-oxazolidin-5-ylidene)methyl]phenoxy]heptoxy]phenyl]methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one.
| Compound Name | 5-[[4-[5-[4-[(4-oxo-2-sulfanylidene-1,3-oxazolidin-5-ylidene)methyl]phenoxy]heptoxy]phenyl]methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 154294586 |
| Molecular Formula | C27H26N2O6S2 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | 5-[[4-[5-[4-[(4-oxo-2-sulfanylidene-1,3-oxazolidin-5-ylidene)methyl]phenoxy]heptoxy]phenyl]methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one |
| SMILES | CCC(CCCCOc1ccc(C=C2OC(=S)NC2=O)cc1)Oc1ccc(C=C2OC(=S)NC2=O)cc1 |
| InChI | InChI=1S/C27H26N2O6S2/c1-2-19(33-21-12-8-18(9-13-21)16-23-25(31)29-27(37)35-23)5-3-4-14-32-20-10-6-17(7-11-20)15-22-24(30)28-26(36)34-22/h6-13,15-16,19H,2-5,14H2,1H3,(H,28,30,36)(H,29,31,37) |
| InChIKey | BWQHMVVJDKUQGP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|