C37H51F5O3S — CID 154294741
(7S,8R,9S,13S,14S)-13-(oxan-2-yloxymethyl)-7-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-8,9,11,12,14,15-hexahydro-7H-cyclopenta[a]phenanthren-6-one (PubChem CID 154294741) has the molecular formula C37H51F5O3S and a molecular weight of 670.87 g/mol. Its IUPAC name is (7S,8R,9S,13S,14S)-13-(oxan-2-yloxymethyl)-7-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-8,9,11,12,14,15-hexahydro-7H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (7S,8R,9S,13S,14S)-13-(oxan-2-yloxymethyl)-7-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-8,9,11,12,14,15-hexahydro-7H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 154294741 |
| Molecular Formula | C37H51F5O3S |
| Molecular Weight | 670.87 g/mol |
| Exact Mass | 670.35 |
| IUPAC Name | (7S,8R,9S,13S,14S)-13-(oxan-2-yloxymethyl)-7-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-8,9,11,12,14,15-hexahydro-7H-cyclopenta[a]phenanthren-6-one |
| SMILES | O=C1c2ccccc2[C@H]2CC[C@]3(COC4CCCCO4)C=CC[C@H]3[C@@H]2[C@@H]1CCCCCCCCCSCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C37H51F5O3S/c38-36(39,37(40,41)42)21-13-25-46-24-11-5-3-1-2-4-6-16-30-33-28(27-14-7-8-15-29(27)34(30)43)19-22-35(20-12-17-31(33)35)26-45-32-18-9-10-23-44-32/h7-8,12,14-15,20,28,30-33H,1-6,9-11,13,16-19,21-26H2/t28-,30+,31+,32?,33+,35+/m1/s1 |
| InChIKey | TXEUYBVFLHYFQQ-GSVLEAJFSA-N |
| XLogP | 10.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.87 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|