About 1,2,4-oxathiazinan-4-ylurea
1,2,4-oxathiazinan-4-ylurea (PubChem CID 154295342) has the molecular formula C4H9N3O2S
and a molecular weight of 163.20 g/mol. Its IUPAC name is 1,2,4-oxathiazinan-4-ylurea.
Molecular Properties
| Compound Name | 1,2,4-oxathiazinan-4-ylurea |
| PubChem CID | 154295342 |
| Molecular Formula | C4H9N3O2S |
| Molecular Weight | 163.20 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 1,2,4-oxathiazinan-4-ylurea |
| SMILES | NC(=O)NN1CCOSC1 |
| InChI | InChI=1S/C4H9N3O2S/c5-4(8)6-7-1-2-9-10-3-7/h1-3H2,(H3,5,6,8) |
| InChIKey | KYAHSDURPSDLGF-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.20 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2,4-oxathiazinan-4-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4-oxathiazinan-4-ylurea?
The IUPAC name of 1,2,4-oxathiazinan-4-ylurea (CID 154295342) is 1,2,4-oxathiazinan-4-ylurea.
What is the SMILES notation for 1,2,4-oxathiazinan-4-ylurea?
The canonical SMILES for 1,2,4-oxathiazinan-4-ylurea is NC(=O)NN1CCOSC1.
What is the InChIKey of 1,2,4-oxathiazinan-4-ylurea?
The InChIKey is KYAHSDURPSDLGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3O2S/c5-4(8)6-7-1-2-9-10-3-7/h1-3H2,(H3,5,6,8).
What are the key properties of 1,2,4-oxathiazinan-4-ylurea?
1,2,4-oxathiazinan-4-ylurea has a molecular weight of 163.20 g/mol, XLogP of -0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4-oxathiazinan-4-ylurea is sourced from PubChem (CID 154295342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).