About 1-[4-(dimethylamino)-3-(trifluoromethyl)phenyl]-1,3-dimethylurea
1-[4-(dimethylamino)-3-(trifluoromethyl)phenyl]-1,3-dimethylurea (PubChem CID 154296957) has the molecular formula C12H16F3N3O
and a molecular weight of 275.27 g/mol. Its IUPAC name is 1-[4-(dimethylamino)-3-(trifluoromethyl)phenyl]-1,3-dimethylurea.
Molecular Properties
| Compound Name | 1-[4-(dimethylamino)-3-(trifluoromethyl)phenyl]-1,3-dimethylurea |
| PubChem CID | 154296957 |
| Molecular Formula | C12H16F3N3O |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 1-[4-(dimethylamino)-3-(trifluoromethyl)phenyl]-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)c1ccc(N(C)C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3N3O/c1-16-11(19)18(4)8-5-6-10(17(2)3)9(7-8)12(13,14)15/h5-7H,1-4H3,(H,16,19) |
| InChIKey | XOMSARFAYYBYTO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(dimethylamino)-3-(trifluoromethyl)phenyl]-1,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(dimethylamino)-3-(trifluoromethyl)phenyl]-1,3-dimethylurea?
The IUPAC name of 1-[4-(dimethylamino)-3-(trifluoromethyl)phenyl]-1,3-dimethylurea (CID 154296957) is 1-[4-(dimethylamino)-3-(trifluoromethyl)phenyl]-1,3-dimethylurea.
What is the SMILES notation for 1-[4-(dimethylamino)-3-(trifluoromethyl)phenyl]-1,3-dimethylurea?
The canonical SMILES for 1-[4-(dimethylamino)-3-(trifluoromethyl)phenyl]-1,3-dimethylurea is CNC(=O)N(C)c1ccc(N(C)C)c(C(F)(F)F)c1.
What is the InChIKey of 1-[4-(dimethylamino)-3-(trifluoromethyl)phenyl]-1,3-dimethylurea?
The InChIKey is XOMSARFAYYBYTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3N3O/c1-16-11(19)18(4)8-5-6-10(17(2)3)9(7-8)12(13,14)15/h5-7H,1-4H3,(H,16,19).
What are the key properties of 1-[4-(dimethylamino)-3-(trifluoromethyl)phenyl]-1,3-dimethylurea?
1-[4-(dimethylamino)-3-(trifluoromethyl)phenyl]-1,3-dimethylurea has a molecular weight of 275.27 g/mol, XLogP of 2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(dimethylamino)-3-(trifluoromethyl)phenyl]-1,3-dimethylurea is sourced from PubChem (CID 154296957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).