C8H16F3NOSi — CID 154297798
N,2-dimethyl-2-(3,3,3-trifluoropropylsilyl)propanamide (PubChem CID 154297798) has the molecular formula C8H16F3NOSi and a molecular weight of 227.30 g/mol. Its IUPAC name is N,2-dimethyl-2-(3,3,3-trifluoropropylsilyl)propanamide.
| Compound Name | N,2-dimethyl-2-(3,3,3-trifluoropropylsilyl)propanamide |
|---|---|
| PubChem CID | 154297798 |
| Molecular Formula | C8H16F3NOSi |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | N,2-dimethyl-2-(3,3,3-trifluoropropylsilyl)propanamide |
| SMILES | CNC(=O)C(C)(C)[SiH2]CCC(F)(F)F |
| InChI | InChI=1S/C8H16F3NOSi/c1-7(2,6(13)12-3)14-5-4-8(9,10)11/h4-5,14H2,1-3H3,(H,12,13) |
| InChIKey | LAIMZGRDXIILCW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|