C14H27F3N2O2 — CID 154299915
(2S,3R,4S)-4-amino-5-cyclohexyl-1-(3,3,3-trifluoropropylamino)pentane-2,3-diol (PubChem CID 154299915) has the molecular formula C14H27F3N2O2 and a molecular weight of 312.38 g/mol. Its IUPAC name is (2S,3R,4S)-4-amino-5-cyclohexyl-1-(3,3,3-trifluoropropylamino)pentane-2,3-diol.
| Compound Name | (2S,3R,4S)-4-amino-5-cyclohexyl-1-(3,3,3-trifluoropropylamino)pentane-2,3-diol |
|---|---|
| PubChem CID | 154299915 |
| Molecular Formula | C14H27F3N2O2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | (2S,3R,4S)-4-amino-5-cyclohexyl-1-(3,3,3-trifluoropropylamino)pentane-2,3-diol |
| SMILES | N[C@@H](CC1CCCCC1)[C@@H](O)[C@@H](O)CNCCC(F)(F)F |
| InChI | InChI=1S/C14H27F3N2O2/c15-14(16,17)6-7-19-9-12(20)13(21)11(18)8-10-4-2-1-3-5-10/h10-13,19-21H,1-9,18H2/t11-,12-,13+/m0/s1 |
| InChIKey | LNKNHOCOMPPFKC-RWMBFGLXSA-N |
| XLogP | 1.55 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|