C15H19N3 — CID 154301165
4-(benzenecarboximidoyl)-1-N,1-N'-dimethylcyclohexa-2,4-diene-1,1-diamine (PubChem CID 154301165) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 4-(benzenecarboximidoyl)-1-N,1-N'-dimethylcyclohexa-2,4-diene-1,1-diamine.
| Compound Name | 4-(benzenecarboximidoyl)-1-N,1-N'-dimethylcyclohexa-2,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 154301165 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 4-(benzenecarboximidoyl)-1-N,1-N'-dimethylcyclohexa-2,4-diene-1,1-diamine |
| SMILES | [H]/N=C(/C1=CCC(NC)(NC)C=C1)c1ccccc1 |
| InChI | InChI=1S/C15H19N3/c1-17-15(18-2)10-8-13(9-11-15)14(16)12-6-4-3-5-7-12/h3-10,16-18H,11H2,1-2H3/b16-14+ |
| InChIKey | XFSMWVPDHYXHMQ-JQIJEIRASA-N |
| XLogP | 2.08 |
| TPSA | 47.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|