C28H41N3O4 — CID 154302153
[(3aS,9bR)-3-[6-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)hexyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl]methyl-methylcarbamic acid (PubChem CID 154302153) has the molecular formula C28H41N3O4 and a molecular weight of 483.65 g/mol. Its IUPAC name is [(3aS,9bR)-3-[6-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)hexyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl]methyl-methylcarbamic acid.
| Compound Name | [(3aS,9bR)-3-[6-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)hexyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 154302153 |
| Molecular Formula | C28H41N3O4 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | [(3aS,9bR)-3-[6-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)hexyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl]methyl-methylcarbamic acid |
| SMILES | CN(Cc1cccc2c1CC[C@H]1[C@@H]2CCN1CCCCCCN1C(=O)CC(C)(C)CC1=O)C(=O)O |
| InChI | InChI=1S/C28H41N3O4/c1-28(2)17-25(32)31(26(33)18-28)15-7-5-4-6-14-30-16-13-23-22-10-8-9-20(19-29(3)27(34)35)21(22)11-12-24(23)30/h8-10,23-24H,4-7,11-19H2,1-3H3,(H,34,35)/t23-,24+/m1/s1 |
| InChIKey | GNMJILNFPSQMKR-RPWUZVMVSA-N |
| XLogP | 4.64 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|