C23H32O2S — CID 15430218
(3aS,6aS)-3-ethenyl-4-(2-hydroxyethyl)-6a-[(E)-5-phenylsulfanylpent-3-enyl]-1,2,3,4,5,6-hexahydropentalen-3a-ol (PubChem CID 15430218) has the molecular formula C23H32O2S and a molecular weight of 372.57 g/mol. Its IUPAC name is (3aS,6aS)-3-ethenyl-4-(2-hydroxyethyl)-6a-[(E)-5-phenylsulfanylpent-3-enyl]-1,2,3,4,5,6-hexahydropentalen-3a-ol.
| Compound Name | (3aS,6aS)-3-ethenyl-4-(2-hydroxyethyl)-6a-[(E)-5-phenylsulfanylpent-3-enyl]-1,2,3,4,5,6-hexahydropentalen-3a-ol |
|---|---|
| PubChem CID | 15430218 |
| Molecular Formula | C23H32O2S |
| Molecular Weight | 372.57 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | (3aS,6aS)-3-ethenyl-4-(2-hydroxyethyl)-6a-[(E)-5-phenylsulfanylpent-3-enyl]-1,2,3,4,5,6-hexahydropentalen-3a-ol |
| SMILES | C=CC1CC[C@]2(CC/C=C/CSc3ccccc3)CCC(CCO)[C@]12O |
| InChI | InChI=1S/C23H32O2S/c1-2-19-11-15-22(16-12-20(13-17-24)23(19,22)25)14-7-4-8-18-26-21-9-5-3-6-10-21/h2-6,8-10,19-20,24-25H,1,7,11-18H2/b8-4+/t19?,20?,22-,23-/m1/s1 |
| InChIKey | QEJJSIMUHYVKIC-YXNGCPHASA-N |
| XLogP | 5.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.57 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|