C13H22F3NO2 — CID 154303044
2-[(1S)-1-cyclohexylethyl]-5,5,5-trifluoro-2-hydroxypentanamide (PubChem CID 154303044) has the molecular formula C13H22F3NO2 and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-[(1S)-1-cyclohexylethyl]-5,5,5-trifluoro-2-hydroxypentanamide.
| Compound Name | 2-[(1S)-1-cyclohexylethyl]-5,5,5-trifluoro-2-hydroxypentanamide |
|---|---|
| PubChem CID | 154303044 |
| Molecular Formula | C13H22F3NO2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-[(1S)-1-cyclohexylethyl]-5,5,5-trifluoro-2-hydroxypentanamide |
| SMILES | C[C@@H](C1CCCCC1)C(O)(CCC(F)(F)F)C(N)=O |
| InChI | InChI=1S/C13H22F3NO2/c1-9(10-5-3-2-4-6-10)12(19,11(17)18)7-8-13(14,15)16/h9-10,19H,2-8H2,1H3,(H2,17,18)/t9-,12?/m0/s1 |
| InChIKey | FREBBMHNPIFLKH-QHGLUPRGSA-N |
| XLogP | 2.76 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |