C20H24N2O4 — CID 15430397
5,8,11,14-tetraoxa-19,22-diazatetracyclo[13.6.4.14,21.018,24]hexacosa-1(21),2,4(26),15(25),16,18(24)-hexaene (PubChem CID 15430397) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 5,8,11,14-tetraoxa-19,22-diazatetracyclo[13.6.4.14,21.018,24]hexacosa-1(21),2,4(26),15(25),16,18(24)-hexaene.
| Compound Name | 5,8,11,14-tetraoxa-19,22-diazatetracyclo[13.6.4.14,21.018,24]hexacosa-1(21),2,4(26),15(25),16,18(24)-hexaene |
|---|---|
| PubChem CID | 15430397 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 5,8,11,14-tetraoxa-19,22-diazatetracyclo[13.6.4.14,21.018,24]hexacosa-1(21),2,4(26),15(25),16,18(24)-hexaene |
| SMILES | c1cc2c3cc1OCCOCCOCCOc1ccc(c(c1)CN2)NC3 |
| InChI | InChI=1S/C20H24N2O4/c1-3-19-15-11-17(1)25-9-7-23-5-6-24-8-10-26-18-2-4-20(22-13-15)16(12-18)14-21-19/h1-4,11-12,21-22H,5-10,13-14H2 |
| InChIKey | DLMQQYVOKAZHKD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|