About 3-ethyl-5-methyl-3a,4-dihydro-2H-1,3-benzothiazole
3-ethyl-5-methyl-3a,4-dihydro-2H-1,3-benzothiazole (PubChem CID 154304382) has the molecular formula C10H15NS
and a molecular weight of 181.30 g/mol. Its IUPAC name is 3-ethyl-5-methyl-3a,4-dihydro-2H-1,3-benzothiazole.
Molecular Properties
| Compound Name | 3-ethyl-5-methyl-3a,4-dihydro-2H-1,3-benzothiazole |
| PubChem CID | 154304382 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 3-ethyl-5-methyl-3a,4-dihydro-2H-1,3-benzothiazole |
| SMILES | CCN1CSC2=CC=C(C)CC21 |
| InChI | InChI=1S/C10H15NS/c1-3-11-7-12-10-5-4-8(2)6-9(10)11/h4-5,9H,3,6-7H2,1-2H3 |
| InChIKey | IICFFKGLVDTCDQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-5-methyl-3a,4-dihydro-2H-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-methyl-3a,4-dihydro-2H-1,3-benzothiazole?
The IUPAC name of 3-ethyl-5-methyl-3a,4-dihydro-2H-1,3-benzothiazole (CID 154304382) is 3-ethyl-5-methyl-3a,4-dihydro-2H-1,3-benzothiazole.
What is the SMILES notation for 3-ethyl-5-methyl-3a,4-dihydro-2H-1,3-benzothiazole?
The canonical SMILES for 3-ethyl-5-methyl-3a,4-dihydro-2H-1,3-benzothiazole is CCN1CSC2=CC=C(C)CC21.
What is the InChIKey of 3-ethyl-5-methyl-3a,4-dihydro-2H-1,3-benzothiazole?
The InChIKey is IICFFKGLVDTCDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NS/c1-3-11-7-12-10-5-4-8(2)6-9(10)11/h4-5,9H,3,6-7H2,1-2H3.
What are the key properties of 3-ethyl-5-methyl-3a,4-dihydro-2H-1,3-benzothiazole?
3-ethyl-5-methyl-3a,4-dihydro-2H-1,3-benzothiazole has a molecular weight of 181.30 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-methyl-3a,4-dihydro-2H-1,3-benzothiazole is sourced from PubChem (CID 154304382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).