2-(2-bromo-4,5-dimethoxy-3-methylphenyl)propanoic acid

C12H15BrO4 — CID 154304830

IUPAC2-(2-bromo-4,5-dimethoxy-3-methylphenyl)propanoic acid
SMILESCOc1cc(C(C)C(=O)O)c(Br)c(C)c1OC
InChIInChI=1S/C12H15BrO4/c1-6(12(14)15)8-5-9(16-3)11(17-4)7(2)10(8)13/h5-6H,1-4H3,(H,14,15)
InChIKeyPVSSNFJDHVVMCC-UHFFFAOYSA-N
MW303.15 g/mol
LogP2.96
Rot. Bonds4

About 2-(2-bromo-4,5-dimethoxy-3-methylphenyl)propanoic acid

2-(2-bromo-4,5-dimethoxy-3-methylphenyl)propanoic acid (PubChem CID 154304830) has the molecular formula C12H15BrO4 and a molecular weight of 303.15 g/mol. Its IUPAC name is 2-(2-bromo-4,5-dimethoxy-3-methylphenyl)propanoic acid.

Molecular Properties

Compound Name2-(2-bromo-4,5-dimethoxy-3-methylphenyl)propanoic acid
PubChem CID154304830
Molecular FormulaC12H15BrO4
Molecular Weight303.15 g/mol
Exact Mass302.02
IUPAC Name2-(2-bromo-4,5-dimethoxy-3-methylphenyl)propanoic acid
SMILESCOc1cc(C(C)C(=O)O)c(Br)c(C)c1OC
InChIInChI=1S/C12H15BrO4/c1-6(12(14)15)8-5-9(16-3)11(17-4)7(2)10(8)13/h5-6H,1-4H3,(H,14,15)
InChIKeyPVSSNFJDHVVMCC-UHFFFAOYSA-N
XLogP2.96
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.15
LogP ≤ 52.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2-bromo-4,5-dimethoxy-3-methylphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-bromo-4,5-dimethoxy-3-methylphenyl)propanoic acid?
The IUPAC name of 2-(2-bromo-4,5-dimethoxy-3-methylphenyl)propanoic acid (CID 154304830) is 2-(2-bromo-4,5-dimethoxy-3-methylphenyl)propanoic acid.
What is the SMILES notation for 2-(2-bromo-4,5-dimethoxy-3-methylphenyl)propanoic acid?
The canonical SMILES for 2-(2-bromo-4,5-dimethoxy-3-methylphenyl)propanoic acid is COc1cc(C(C)C(=O)O)c(Br)c(C)c1OC.
What is the InChIKey of 2-(2-bromo-4,5-dimethoxy-3-methylphenyl)propanoic acid?
The InChIKey is PVSSNFJDHVVMCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrO4/c1-6(12(14)15)8-5-9(16-3)11(17-4)7(2)10(8)13/h5-6H,1-4H3,(H,14,15).
What are the key properties of 2-(2-bromo-4,5-dimethoxy-3-methylphenyl)propanoic acid?
2-(2-bromo-4,5-dimethoxy-3-methylphenyl)propanoic acid has a molecular weight of 303.15 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromo-4,5-dimethoxy-3-methylphenyl)propanoic acid is sourced from PubChem (CID 154304830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).