C14H8Cl3F3N2 — CID 15430508
2,4,6-trichloro-N-[(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino]aniline (PubChem CID 15430508) has the molecular formula C14H8Cl3F3N2 and a molecular weight of 367.59 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino]aniline.
| Compound Name | 2,4,6-trichloro-N-[(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino]aniline |
|---|---|
| PubChem CID | 15430508 |
| Molecular Formula | C14H8Cl3F3N2 |
| Molecular Weight | 367.59 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | 2,4,6-trichloro-N-[(Z)-(2,2,2-trifluoro-1-phenylethylidene)amino]aniline |
| SMILES | FC(F)(F)/C(=N\Nc1c(Cl)cc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C14H8Cl3F3N2/c15-9-6-10(16)12(11(17)7-9)21-22-13(14(18,19)20)8-4-2-1-3-5-8/h1-7,21H/b22-13- |
| InChIKey | CFXIXWOIVHPBRC-XKZIYDEJSA-N |
| XLogP | 6.03 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|