C26H14F2OS — CID 154306004
1,5-bis(4-fluorophenyl)-10-sulfanylideneanthracen-9-one (PubChem CID 154306004) has the molecular formula C26H14F2OS and a molecular weight of 412.46 g/mol. Its IUPAC name is 1,5-bis(4-fluorophenyl)-10-sulfanylideneanthracen-9-one.
| Compound Name | 1,5-bis(4-fluorophenyl)-10-sulfanylideneanthracen-9-one |
|---|---|
| PubChem CID | 154306004 |
| Molecular Formula | C26H14F2OS |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 1,5-bis(4-fluorophenyl)-10-sulfanylideneanthracen-9-one |
| SMILES | O=C1c2cccc(-c3ccc(F)cc3)c2C(=S)c2cccc(-c3ccc(F)cc3)c21 |
| InChI | InChI=1S/C26H14F2OS/c27-17-11-7-15(8-12-17)19-3-2-6-22-23(19)25(29)21-5-1-4-20(24(21)26(22)30)16-9-13-18(28)14-10-16/h1-14H |
| InChIKey | PZTREXBKMLYNJK-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|