C23H34N2O2 — CID 154307324
[(3aS,9bS)-3-(2-cyclohexylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl]methyl-methylcarbamic acid (PubChem CID 154307324) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is [(3aS,9bS)-3-(2-cyclohexylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl]methyl-methylcarbamic acid.
| Compound Name | [(3aS,9bS)-3-(2-cyclohexylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 154307324 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | [(3aS,9bS)-3-(2-cyclohexylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl]methyl-methylcarbamic acid |
| SMILES | CN(Cc1cccc2c1CC[C@H]1[C@H]2CCN1CCC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C23H34N2O2/c1-24(23(26)27)16-18-8-5-9-20-19(18)10-11-22-21(20)13-15-25(22)14-12-17-6-3-2-4-7-17/h5,8-9,17,21-22H,2-4,6-7,10-16H2,1H3,(H,26,27)/t21-,22-/m0/s1 |
| InChIKey | YNZFSOVHUUFVKH-VXKWHMMOSA-N |
| XLogP | 4.87 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |