About 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]propanamide
2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]propanamide (PubChem CID 154307719) has the molecular formula C7H13F3N2O3S
and a molecular weight of 262.25 g/mol. Its IUPAC name is 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]propanamide.
Molecular Properties
| Compound Name | 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]propanamide |
| PubChem CID | 154307719 |
| Molecular Formula | C7H13F3N2O3S |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]propanamide |
| SMILES | CC(C(N)=O)S(=O)(=O)N(C)CCC(F)(F)F |
| InChI | InChI=1S/C7H13F3N2O3S/c1-5(6(11)13)16(14,15)12(2)4-3-7(8,9)10/h5H,3-4H2,1-2H3,(H2,11,13) |
| InChIKey | DKGZXAOAOJRAKA-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]propanamide?
The IUPAC name of 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]propanamide (CID 154307719) is 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]propanamide.
What is the SMILES notation for 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]propanamide?
The canonical SMILES for 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]propanamide is CC(C(N)=O)S(=O)(=O)N(C)CCC(F)(F)F.
What is the InChIKey of 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]propanamide?
The InChIKey is DKGZXAOAOJRAKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F3N2O3S/c1-5(6(11)13)16(14,15)12(2)4-3-7(8,9)10/h5H,3-4H2,1-2H3,(H2,11,13).
What are the key properties of 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]propanamide?
2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]propanamide has a molecular weight of 262.25 g/mol, XLogP of 0.07, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]propanamide is sourced from PubChem (CID 154307719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).