C18H17F4N3O2 — CID 154310182
4-(2-fluoroethyl)-1-[(1-oxidopyridin-1-ium-4-yl)methyl]-3-(2,2,2-trifluoroethyl)-4H-quinazolin-2-one (PubChem CID 154310182) has the molecular formula C18H17F4N3O2 and a molecular weight of 383.35 g/mol. Its IUPAC name is 4-(2-fluoroethyl)-1-[(1-oxidopyridin-1-ium-4-yl)methyl]-3-(2,2,2-trifluoroethyl)-4H-quinazolin-2-one.
| Compound Name | 4-(2-fluoroethyl)-1-[(1-oxidopyridin-1-ium-4-yl)methyl]-3-(2,2,2-trifluoroethyl)-4H-quinazolin-2-one |
|---|---|
| PubChem CID | 154310182 |
| Molecular Formula | C18H17F4N3O2 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 4-(2-fluoroethyl)-1-[(1-oxidopyridin-1-ium-4-yl)methyl]-3-(2,2,2-trifluoroethyl)-4H-quinazolin-2-one |
| SMILES | O=C1N(Cc2cc[n+]([O-])cc2)c2ccccc2C(CCF)N1CC(F)(F)F |
| InChI | InChI=1S/C18H17F4N3O2/c19-8-5-16-14-3-1-2-4-15(14)24(11-13-6-9-23(27)10-7-13)17(26)25(16)12-18(20,21)22/h1-4,6-7,9-10,16H,5,8,11-12H2 |
| InChIKey | JHHFKBDNTOKXOB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|