About 7-O-tert-butyl 2-O-ethyl bicyclo[3.3.1]non-2-ene-2,7-dicarboxylate
7-O-tert-butyl 2-O-ethyl bicyclo[3.3.1]non-2-ene-2,7-dicarboxylate (PubChem CID 154310575) has the molecular formula C17H26O4
and a molecular weight of 294.39 g/mol. Its IUPAC name is 7-O-tert-butyl 2-O-ethyl bicyclo[3.3.1]non-2-ene-2,7-dicarboxylate.
Analyze 7-O-tert-butyl 2-O-ethyl bicyclo[3.3.1]non-2-ene-2,7-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-O-tert-butyl 2-O-ethyl bicyclo[3.3.1]non-2-ene-2,7-dicarboxylate?
The IUPAC name of 7-O-tert-butyl 2-O-ethyl bicyclo[3.3.1]non-2-ene-2,7-dicarboxylate (CID 154310575) is 7-O-tert-butyl 2-O-ethyl bicyclo[3.3.1]non-2-ene-2,7-dicarboxylate.
What is the SMILES notation for 7-O-tert-butyl 2-O-ethyl bicyclo[3.3.1]non-2-ene-2,7-dicarboxylate?
The canonical SMILES for 7-O-tert-butyl 2-O-ethyl bicyclo[3.3.1]non-2-ene-2,7-dicarboxylate is CCOC(=O)C1=CCC2CC(C(=O)OC(C)(C)C)CC1C2.
What is the InChIKey of 7-O-tert-butyl 2-O-ethyl bicyclo[3.3.1]non-2-ene-2,7-dicarboxylate?
The InChIKey is HQVZBOCTJGFTDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O4/c1-5-20-16(19)14-7-6-11-8-12(14)10-13(9-11)15(18)21-17(2,3)4/h7,11-13H,5-6,8-10H2,1-4H3.
What are the key properties of 7-O-tert-butyl 2-O-ethyl bicyclo[3.3.1]non-2-ene-2,7-dicarboxylate?
7-O-tert-butyl 2-O-ethyl bicyclo[3.3.1]non-2-ene-2,7-dicarboxylate has a molecular weight of 294.39 g/mol, XLogP of 3.25, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-O-tert-butyl 2-O-ethyl bicyclo[3.3.1]non-2-ene-2,7-dicarboxylate is sourced from PubChem (CID 154310575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).