C21H19ClN2O5 — CID 154311535
2-chloro-5,6-dimethoxy-N-methyl-4-oxo-N-(4-phenoxyphenyl)-1H-pyridine-3-carboxamide (PubChem CID 154311535) has the molecular formula C21H19ClN2O5 and a molecular weight of 414.85 g/mol. Its IUPAC name is 2-chloro-5,6-dimethoxy-N-methyl-4-oxo-N-(4-phenoxyphenyl)-1H-pyridine-3-carboxamide.
| Compound Name | 2-chloro-5,6-dimethoxy-N-methyl-4-oxo-N-(4-phenoxyphenyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 154311535 |
| Molecular Formula | C21H19ClN2O5 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 2-chloro-5,6-dimethoxy-N-methyl-4-oxo-N-(4-phenoxyphenyl)-1H-pyridine-3-carboxamide |
| SMILES | COc1[nH]c(Cl)c(C(=O)N(C)c2ccc(Oc3ccccc3)cc2)c(=O)c1OC |
| InChI | InChI=1S/C21H19ClN2O5/c1-24(13-9-11-15(12-10-13)29-14-7-5-4-6-8-14)21(26)16-17(25)18(27-2)20(28-3)23-19(16)22/h4-12H,1-3H3,(H,23,25) |
| InChIKey | FZEZCMFROTXDDW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|