C15H14 — CID 154311656
tricyclo[9.4.0.01,6]pentadeca-2,4,6,8,11,13-hexaene (PubChem CID 154311656) has the molecular formula C15H14 and a molecular weight of 194.28 g/mol. Its IUPAC name is tricyclo[9.4.0.01,6]pentadeca-2,4,6,8,11,13-hexaene.
| Compound Name | tricyclo[9.4.0.01,6]pentadeca-2,4,6,8,11,13-hexaene |
|---|---|
| PubChem CID | 154311656 |
| Molecular Formula | C15H14 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | tricyclo[9.4.0.01,6]pentadeca-2,4,6,8,11,13-hexaene |
| SMILES | C1=CCC2=CC=CCC23C=CC=CC3=C1 |
| InChI | InChI=1S/C15H14/c1-2-8-14-10-4-6-12-15(14)11-5-3-9-13(15)7-1/h1-7,9-11H,8,12H2 |
| InChIKey | BBTGWJWEBLBVAQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |