C16H15F8N3O6S — CID 154312112
(3-hydroxyazetidin-1-yl)-[[(2S)-8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyimino]-oxidoazanium (PubChem CID 154312112) has the molecular formula C16H15F8N3O6S and a molecular weight of 529.36 g/mol. Its IUPAC name is (3-hydroxyazetidin-1-yl)-[[(2S)-8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyimino]-oxidoazanium.
| Compound Name | (3-hydroxyazetidin-1-yl)-[[(2S)-8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyimino]-oxidoazanium |
|---|---|
| PubChem CID | 154312112 |
| Molecular Formula | C16H15F8N3O6S |
| Molecular Weight | 529.36 g/mol |
| Exact Mass | 529.06 |
| IUPAC Name | (3-hydroxyazetidin-1-yl)-[[(2S)-8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyimino]-oxidoazanium |
| SMILES | Cc1cc(S(F)(F)(F)(F)F)cc2c1O[C@H](C(F)(F)F)C(C(=O)OCON=[N+]([O-])N1CC(O)C1)=C2 |
| InChI | InChI=1S/C16H15F8N3O6S/c1-8-2-11(34(20,21,22,23)24)3-9-4-12(14(16(17,18)19)33-13(8)9)15(29)31-7-32-25-27(30)26-5-10(28)6-26/h2-4,10,14,28H,5-7H2,1H3/t14-/m0/s1 |
| InChIKey | DYKDZKGJSMIDRS-AWEZNQCLSA-N |
| XLogP | 4.35 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|