About 3-oxobutanoyl dodecanoate
3-oxobutanoyl dodecanoate (PubChem CID 154312748) has the molecular formula C16H28O4
and a molecular weight of 284.40 g/mol. Its IUPAC name is 3-oxobutanoyl dodecanoate.
Molecular Properties
| Compound Name | 3-oxobutanoyl dodecanoate |
| PubChem CID | 154312748 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 3-oxobutanoyl dodecanoate |
| SMILES | CCCCCCCCCCCC(=O)OC(=O)CC(C)=O |
| InChI | InChI=1S/C16H28O4/c1-3-4-5-6-7-8-9-10-11-12-15(18)20-16(19)13-14(2)17/h3-13H2,1-2H3 |
| InChIKey | AHWOYFACEPIKAI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-oxobutanoyl dodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxobutanoyl dodecanoate?
The IUPAC name of 3-oxobutanoyl dodecanoate (CID 154312748) is 3-oxobutanoyl dodecanoate.
What is the SMILES notation for 3-oxobutanoyl dodecanoate?
The canonical SMILES for 3-oxobutanoyl dodecanoate is CCCCCCCCCCCC(=O)OC(=O)CC(C)=O.
What is the InChIKey of 3-oxobutanoyl dodecanoate?
The InChIKey is AHWOYFACEPIKAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O4/c1-3-4-5-6-7-8-9-10-11-12-15(18)20-16(19)13-14(2)17/h3-13H2,1-2H3.
What are the key properties of 3-oxobutanoyl dodecanoate?
3-oxobutanoyl dodecanoate has a molecular weight of 284.40 g/mol, XLogP of 3.96, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxobutanoyl dodecanoate is sourced from PubChem (CID 154312748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).