C27H33N3O3 — CID 154314465
[(3aS,9bR)-3-[4-(3-oxo-1H-isoindol-2-yl)butyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl]methyl-methylcarbamic acid (PubChem CID 154314465) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is [(3aS,9bR)-3-[4-(3-oxo-1H-isoindol-2-yl)butyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl]methyl-methylcarbamic acid.
| Compound Name | [(3aS,9bR)-3-[4-(3-oxo-1H-isoindol-2-yl)butyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 154314465 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | [(3aS,9bR)-3-[4-(3-oxo-1H-isoindol-2-yl)butyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl]methyl-methylcarbamic acid |
| SMILES | CN(Cc1cccc2c1CC[C@H]1[C@@H]2CCN1CCCCN1Cc2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C27H33N3O3/c1-28(27(32)33)17-19-8-6-10-23-21(19)11-12-25-24(23)13-16-29(25)14-4-5-15-30-18-20-7-2-3-9-22(20)26(30)31/h2-3,6-10,24-25H,4-5,11-18H2,1H3,(H,32,33)/t24-,25+/m1/s1 |
| InChIKey | LRFGKGWOGUHOCY-RPBOFIJWSA-N |
| XLogP | 4.34 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|