C7H10F3N3 — CID 154318582
2-(2,2,2-trifluoroethyl)-1H-pyridine-2,5-diamine (PubChem CID 154318582) has the molecular formula C7H10F3N3 and a molecular weight of 193.17 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethyl)-1H-pyridine-2,5-diamine.
| Compound Name | 2-(2,2,2-trifluoroethyl)-1H-pyridine-2,5-diamine |
|---|---|
| PubChem CID | 154318582 |
| Molecular Formula | C7H10F3N3 |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.08 |
| IUPAC Name | 2-(2,2,2-trifluoroethyl)-1H-pyridine-2,5-diamine |
| SMILES | NC1=CNC(N)(CC(F)(F)F)C=C1 |
| InChI | InChI=1S/C7H10F3N3/c8-7(9,10)4-6(12)2-1-5(11)3-13-6/h1-3,13H,4,11-12H2 |
| InChIKey | LSCYFJFVUDSUEQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |