C25H15F3N4O3 — CID 154320699
2-[[4-[2-benzoyl-6-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]isoindole-1,3-dione (PubChem CID 154320699) has the molecular formula C25H15F3N4O3 and a molecular weight of 476.41 g/mol. Its IUPAC name is 2-[[4-[2-benzoyl-6-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[2-benzoyl-6-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 154320699 |
| Molecular Formula | C25H15F3N4O3 |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 2-[[4-[2-benzoyl-6-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C(c1ccccc1)c1cccc(C(F)(F)F)c1-n1cnnc1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H15F3N4O3/c26-25(27,28)19-12-6-11-18(22(33)15-7-2-1-3-8-15)21(19)32-14-29-30-20(32)13-31-23(34)16-9-4-5-10-17(16)24(31)35/h1-12,14H,13H2 |
| InChIKey | WRCMATXAZARBKJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|