About 2-methylpropane;oxotantalum
2-methylpropane;oxotantalum (PubChem CID 154320784) has the molecular formula C4H9OTa-
and a molecular weight of 254.06 g/mol. Its IUPAC name is 2-methylpropane;oxotantalum.
Molecular Properties
| Compound Name | 2-methylpropane;oxotantalum |
| PubChem CID | 154320784 |
| Molecular Formula | C4H9OTa- |
| Molecular Weight | 254.06 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 2-methylpropane;oxotantalum |
| SMILES | C[C-](C)C.O=[Ta] |
| InChI | InChI=1S/C4H9.O.Ta/c1-4(2)3;;/h1-3H3;;/q-1;; |
| InChIKey | KJXYFIUAHXVNNG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.06 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropane;oxotantalum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;oxotantalum?
The IUPAC name of 2-methylpropane;oxotantalum (CID 154320784) is 2-methylpropane;oxotantalum.
What is the SMILES notation for 2-methylpropane;oxotantalum?
The canonical SMILES for 2-methylpropane;oxotantalum is C[C-](C)C.O=[Ta].
What is the InChIKey of 2-methylpropane;oxotantalum?
The InChIKey is KJXYFIUAHXVNNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9.O.Ta/c1-4(2)3;;/h1-3H3;;/q-1;;.
What are the key properties of 2-methylpropane;oxotantalum?
2-methylpropane;oxotantalum has a molecular weight of 254.06 g/mol, XLogP of 1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;oxotantalum is sourced from PubChem (CID 154320784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).