About 1,2,3,4-tetrahydropyrimido[5,4-e][1,4]diazepin-9-one
1,2,3,4-tetrahydropyrimido[5,4-e][1,4]diazepin-9-one (PubChem CID 154321647) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is 1,2,3,4-tetrahydropyrimido[5,4-e][1,4]diazepin-9-one.
Analyze 1,2,3,4-tetrahydropyrimido[5,4-e][1,4]diazepin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,4-tetrahydropyrimido[5,4-e][1,4]diazepin-9-one?
The IUPAC name of 1,2,3,4-tetrahydropyrimido[5,4-e][1,4]diazepin-9-one (CID 154321647) is 1,2,3,4-tetrahydropyrimido[5,4-e][1,4]diazepin-9-one.
What is the SMILES notation for 1,2,3,4-tetrahydropyrimido[5,4-e][1,4]diazepin-9-one?
The canonical SMILES for 1,2,3,4-tetrahydropyrimido[5,4-e][1,4]diazepin-9-one is O=c1nccnc2c1NCNC2.
What is the InChIKey of 1,2,3,4-tetrahydropyrimido[5,4-e][1,4]diazepin-9-one?
The InChIKey is UHCJVBXFENTINJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c12-7-6-5(3-8-4-11-6)9-1-2-10-7/h1-2,8,11H,3-4H2.
What are the key properties of 1,2,3,4-tetrahydropyrimido[5,4-e][1,4]diazepin-9-one?
1,2,3,4-tetrahydropyrimido[5,4-e][1,4]diazepin-9-one has a molecular weight of 164.17 g/mol, XLogP of -0.69, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,4-tetrahydropyrimido[5,4-e][1,4]diazepin-9-one is sourced from PubChem (CID 154321647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).