C5H4BrF7 — CID 154324929
1-bromo-1,1,2,2,5,5,5-heptafluoropentane (PubChem CID 154324929) has the molecular formula C5H4BrF7 and a molecular weight of 276.98 g/mol. Its IUPAC name is 1-bromo-1,1,2,2,5,5,5-heptafluoropentane.
| Compound Name | 1-bromo-1,1,2,2,5,5,5-heptafluoropentane |
|---|---|
| PubChem CID | 154324929 |
| Molecular Formula | C5H4BrF7 |
| Molecular Weight | 276.98 g/mol |
| Exact Mass | 275.94 |
| IUPAC Name | 1-bromo-1,1,2,2,5,5,5-heptafluoropentane |
| SMILES | FC(F)(F)CCC(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C5H4BrF7/c6-5(12,13)3(7,8)1-2-4(9,10)11/h1-2H2 |
| InChIKey | SOWYRMQJFYAAPF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.98 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|