C16H20O3 — CID 15432548
methyl 5-[(1E,5E)-2,6-dimethylocta-1,5,7-trienyl]furan-3-carboxylate (PubChem CID 15432548) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is methyl 5-[(1E,5E)-2,6-dimethylocta-1,5,7-trienyl]furan-3-carboxylate.
| Compound Name | methyl 5-[(1E,5E)-2,6-dimethylocta-1,5,7-trienyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 15432548 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | methyl 5-[(1E,5E)-2,6-dimethylocta-1,5,7-trienyl]furan-3-carboxylate |
| SMILES | C=C/C(C)=C/CC/C(C)=C/c1cc(C(=O)OC)co1 |
| InChI | InChI=1S/C16H20O3/c1-5-12(2)7-6-8-13(3)9-15-10-14(11-19-15)16(17)18-4/h5,7,9-11H,1,6,8H2,2-4H3/b12-7+,13-9+ |
| InChIKey | SOGGMEVKELOHJA-QYFNTBEASA-N |
| XLogP | 4.38 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|