C12H7F21O3Si — CID 154326883
tris(1,1,2,2,4,4,4-heptafluorobutoxy)silane (PubChem CID 154326883) has the molecular formula C12H7F21O3Si and a molecular weight of 626.23 g/mol. Its IUPAC name is tris(1,1,2,2,4,4,4-heptafluorobutoxy)silane.
| Compound Name | tris(1,1,2,2,4,4,4-heptafluorobutoxy)silane |
|---|---|
| PubChem CID | 154326883 |
| Molecular Formula | C12H7F21O3Si |
| Molecular Weight | 626.23 g/mol |
| Exact Mass | 625.98 |
| IUPAC Name | tris(1,1,2,2,4,4,4-heptafluorobutoxy)silane |
| SMILES | FC(F)(F)CC(F)(F)C(F)(F)O[SiH](OC(F)(F)C(F)(F)CC(F)(F)F)OC(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C12H7F21O3Si/c13-4(14,1-7(19,20)21)10(28,29)34-37(35-11(30,31)5(15,16)2-8(22,23)24)36-12(32,33)6(17,18)3-9(25,26)27/h37H,1-3H2 |
| InChIKey | XUCOVRYWAXKPTM-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.23 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|