About (6E)-6-methyl-10-triethylsilyloxycyclodeca-2,6-dien-1-one
(6E)-6-methyl-10-triethylsilyloxycyclodeca-2,6-dien-1-one (PubChem CID 154327342) has the molecular formula C17H30O2Si
and a molecular weight of 294.51 g/mol. Its IUPAC name is (6E)-6-methyl-10-triethylsilyloxycyclodeca-2,6-dien-1-one.
Molecular Properties
| Compound Name | (6E)-6-methyl-10-triethylsilyloxycyclodeca-2,6-dien-1-one |
| PubChem CID | 154327342 |
| Molecular Formula | C17H30O2Si |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | (6E)-6-methyl-10-triethylsilyloxycyclodeca-2,6-dien-1-one |
| SMILES | CC[Si](CC)(CC)OC1CC/C=C(\C)CCC=CC1=O |
| InChI | InChI=1S/C17H30O2Si/c1-5-20(6-2,7-3)19-17-14-10-12-15(4)11-8-9-13-16(17)18/h9,12-13,17H,5-8,10-11,14H2,1-4H3/b13-9?,15-12+ |
| InChIKey | XVESNQGYASLBKK-FCHORICQSA-N |
| XLogP | 5.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6E)-6-methyl-10-triethylsilyloxycyclodeca-2,6-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-6-methyl-10-triethylsilyloxycyclodeca-2,6-dien-1-one?
The IUPAC name of (6E)-6-methyl-10-triethylsilyloxycyclodeca-2,6-dien-1-one (CID 154327342) is (6E)-6-methyl-10-triethylsilyloxycyclodeca-2,6-dien-1-one.
What is the SMILES notation for (6E)-6-methyl-10-triethylsilyloxycyclodeca-2,6-dien-1-one?
The canonical SMILES for (6E)-6-methyl-10-triethylsilyloxycyclodeca-2,6-dien-1-one is CC[Si](CC)(CC)OC1CC/C=C(\C)CCC=CC1=O.
What is the InChIKey of (6E)-6-methyl-10-triethylsilyloxycyclodeca-2,6-dien-1-one?
The InChIKey is XVESNQGYASLBKK-FCHORICQSA-N. The full InChI is InChI=1S/C17H30O2Si/c1-5-20(6-2,7-3)19-17-14-10-12-15(4)11-8-9-13-16(17)18/h9,12-13,17H,5-8,10-11,14H2,1-4H3/b13-9?,15-12+.
What are the key properties of (6E)-6-methyl-10-triethylsilyloxycyclodeca-2,6-dien-1-one?
(6E)-6-methyl-10-triethylsilyloxycyclodeca-2,6-dien-1-one has a molecular weight of 294.51 g/mol, XLogP of 5.02, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-6-methyl-10-triethylsilyloxycyclodeca-2,6-dien-1-one is sourced from PubChem (CID 154327342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).