C30H31ClN2O3 — CID 154327876
1-[3-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-N-[(4-chlorophenyl)methoxy]ethanimine (PubChem CID 154327876) has the molecular formula C30H31ClN2O3 and a molecular weight of 503.04 g/mol. Its IUPAC name is 1-[3-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-N-[(4-chlorophenyl)methoxy]ethanimine.
| Compound Name | 1-[3-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-N-[(4-chlorophenyl)methoxy]ethanimine |
|---|---|
| PubChem CID | 154327876 |
| Molecular Formula | C30H31ClN2O3 |
| Molecular Weight | 503.04 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 1-[3-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-N-[(4-chlorophenyl)methoxy]ethanimine |
| SMILES | COc1cc2c(cc1OC)[C@H]1CCCC[C@H]1N=C2c1cccc(C(C)=NOCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C30H31ClN2O3/c1-19(33-36-18-20-11-13-23(31)14-12-20)21-7-6-8-22(15-21)30-26-17-29(35-3)28(34-2)16-25(26)24-9-4-5-10-27(24)32-30/h6-8,11-17,24,27H,4-5,9-10,18H2,1-3H3/t24-,27-/m1/s1 |
| InChIKey | OYOWPARFPFXBIA-SHQCIBLASA-N |
| XLogP | 7.18 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.04 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|