C14H14N4O2 — CID 15432802
N-(diaminomethylidene)-6-methyl-9-oxo-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxamide (PubChem CID 15432802) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is N-(diaminomethylidene)-6-methyl-9-oxo-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxamide.
| Compound Name | N-(diaminomethylidene)-6-methyl-9-oxo-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxamide |
|---|---|
| PubChem CID | 15432802 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | N-(diaminomethylidene)-6-methyl-9-oxo-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxamide |
| SMILES | Cc1cc2c3c(c1)cc(C(=O)N=C(N)N)n3CCC2=O |
| InChI | InChI=1S/C14H14N4O2/c1-7-4-8-6-10(13(20)17-14(15)16)18-3-2-11(19)9(5-7)12(8)18/h4-6H,2-3H2,1H3,(H4,15,16,17,20) |
| InChIKey | KGSVKRQRUNTGOW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|