C24H20ClN5S — CID 15432922
3-benzyl-9-(3-chlorophenyl)-17-thia-2,4,5,8,14-pentazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,8,11(16)-pentaene (PubChem CID 15432922) has the molecular formula C24H20ClN5S and a molecular weight of 445.98 g/mol. Its IUPAC name is 3-benzyl-9-(3-chlorophenyl)-17-thia-2,4,5,8,14-pentazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,8,11(16)-pentaene.
| Compound Name | 3-benzyl-9-(3-chlorophenyl)-17-thia-2,4,5,8,14-pentazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,8,11(16)-pentaene |
|---|---|
| PubChem CID | 15432922 |
| Molecular Formula | C24H20ClN5S |
| Molecular Weight | 445.98 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 3-benzyl-9-(3-chlorophenyl)-17-thia-2,4,5,8,14-pentazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,8,11(16)-pentaene |
| SMILES | Clc1cccc(C2=NCc3nnc(Cc4ccccc4)n3-c3sc4c(c32)CCNC4)c1 |
| InChI | InChI=1S/C24H20ClN5S/c25-17-8-4-7-16(12-17)23-22-18-9-10-26-13-19(18)31-24(22)30-20(28-29-21(30)14-27-23)11-15-5-2-1-3-6-15/h1-8,12,26H,9-11,13-14H2 |
| InChIKey | QCNQHGCWYZCCLE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.98 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |