C16H14N2O — CID 154330189
8,11-diazatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,13,15,17-hexaen-9-one (PubChem CID 154330189) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is 8,11-diazatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,13,15,17-hexaen-9-one.
| Compound Name | 8,11-diazatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,13,15,17-hexaen-9-one |
|---|---|
| PubChem CID | 154330189 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 8,11-diazatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,13,15,17-hexaen-9-one |
| SMILES | O=C1CN2Cc3ccccc3C2c2ccccc2N1 |
| InChI | InChI=1S/C16H14N2O/c19-15-10-18-9-11-5-1-2-6-12(11)16(18)13-7-3-4-8-14(13)17-15/h1-8,16H,9-10H2,(H,17,19) |
| InChIKey | XTTKCHOEPVXUHJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |