C44H47N5O — CID 15433025
N-anthracen-1-yl-2-(5,5,10,10,15,15,20,20-octamethyl-21,22,23,24-tetrahydroporphyrin-2-yl)acetamide (PubChem CID 15433025) has the molecular formula C44H47N5O and a molecular weight of 661.89 g/mol. Its IUPAC name is N-anthracen-1-yl-2-(5,5,10,10,15,15,20,20-octamethyl-21,22,23,24-tetrahydroporphyrin-2-yl)acetamide.
| Compound Name | N-anthracen-1-yl-2-(5,5,10,10,15,15,20,20-octamethyl-21,22,23,24-tetrahydroporphyrin-2-yl)acetamide |
|---|---|
| PubChem CID | 15433025 |
| Molecular Formula | C44H47N5O |
| Molecular Weight | 661.89 g/mol |
| Exact Mass | 661.38 |
| IUPAC Name | N-anthracen-1-yl-2-(5,5,10,10,15,15,20,20-octamethyl-21,22,23,24-tetrahydroporphyrin-2-yl)acetamide |
| SMILES | CC1(C)c2ccc([nH]2)C(C)(C)c2ccc([nH]2)C(C)(C)c2[nH]c(cc2CC(=O)Nc2cccc3cc4ccccc4cc23)C(C)(C)c2ccc1[nH]2 |
| InChI | InChI=1S/C44H47N5O/c1-41(2)32-16-17-33(46-32)42(3,4)35-20-21-37(48-35)44(7,8)40-29(24-38(49-40)43(5,6)36-19-18-34(41)47-36)25-39(50)45-31-15-11-14-28-22-26-12-9-10-13-27(26)23-30(28)31/h9-24,46-49H,25H2,1-8H3,(H,45,50) |
| InChIKey | ZHKRVOJCRGDMAZ-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.89 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|