About 2-(2,2-difluoroethyl)-1H-pyridine-2,3-diamine
2-(2,2-difluoroethyl)-1H-pyridine-2,3-diamine (PubChem CID 154333370) has the molecular formula C7H11F2N3
and a molecular weight of 175.18 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-1H-pyridine-2,3-diamine.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethyl)-1H-pyridine-2,3-diamine |
| PubChem CID | 154333370 |
| Molecular Formula | C7H11F2N3 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | 2-(2,2-difluoroethyl)-1H-pyridine-2,3-diamine |
| SMILES | NC1=CC=CNC1(N)CC(F)F |
| InChI | InChI=1S/C7H11F2N3/c8-6(9)4-7(11)5(10)2-1-3-12-7/h1-3,6,12H,4,10-11H2 |
| InChIKey | OOAIOQMHHCOQGL-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,2-difluoroethyl)-1H-pyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethyl)-1H-pyridine-2,3-diamine?
The IUPAC name of 2-(2,2-difluoroethyl)-1H-pyridine-2,3-diamine (CID 154333370) is 2-(2,2-difluoroethyl)-1H-pyridine-2,3-diamine.
What is the SMILES notation for 2-(2,2-difluoroethyl)-1H-pyridine-2,3-diamine?
The canonical SMILES for 2-(2,2-difluoroethyl)-1H-pyridine-2,3-diamine is NC1=CC=CNC1(N)CC(F)F.
What is the InChIKey of 2-(2,2-difluoroethyl)-1H-pyridine-2,3-diamine?
The InChIKey is OOAIOQMHHCOQGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2N3/c8-6(9)4-7(11)5(10)2-1-3-12-7/h1-3,6,12H,4,10-11H2.
What are the key properties of 2-(2,2-difluoroethyl)-1H-pyridine-2,3-diamine?
2-(2,2-difluoroethyl)-1H-pyridine-2,3-diamine has a molecular weight of 175.18 g/mol, XLogP of 0.26, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethyl)-1H-pyridine-2,3-diamine is sourced from PubChem (CID 154333370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).