C11H20N2O3 — CID 15433421
tert-butyl N-[(3aS,6R,6aR)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-6-yl]carbamate (PubChem CID 15433421) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is tert-butyl N-[(3aS,6R,6aR)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-6-yl]carbamate.
| Compound Name | tert-butyl N-[(3aS,6R,6aR)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-6-yl]carbamate |
|---|---|
| PubChem CID | 15433421 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | tert-butyl N-[(3aS,6R,6aR)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-6-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CN[C@H]2CCO[C@H]21 |
| InChI | InChI=1S/C11H20N2O3/c1-11(2,3)16-10(14)13-8-6-12-7-4-5-15-9(7)8/h7-9,12H,4-6H2,1-3H3,(H,13,14)/t7-,8+,9+/m0/s1 |
| InChIKey | CPZARJFNNPCWQM-DJLDLDEBSA-N |
| XLogP | 0.64 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |