C27H29F5O2S — CID 154334443
(8S,13S,14S)-13-methyl-1-(4-methylsulfinylphenyl)-17-(1,1,2,2,2-pentafluoroethyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 154334443) has the molecular formula C27H29F5O2S and a molecular weight of 512.58 g/mol. Its IUPAC name is (8S,13S,14S)-13-methyl-1-(4-methylsulfinylphenyl)-17-(1,1,2,2,2-pentafluoroethyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,13S,14S)-13-methyl-1-(4-methylsulfinylphenyl)-17-(1,1,2,2,2-pentafluoroethyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 154334443 |
| Molecular Formula | C27H29F5O2S |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | (8S,13S,14S)-13-methyl-1-(4-methylsulfinylphenyl)-17-(1,1,2,2,2-pentafluoroethyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CS(=O)c1ccc(C2CC(=O)C=C3CC[C@@H]4C(=C32)CC[C@]2(C)C(C(F)(F)C(F)(F)F)CC[C@@H]42)cc1 |
| InChI | InChI=1S/C27H29F5O2S/c1-25-12-11-20-19(22(25)9-10-23(25)26(28,29)27(30,31)32)8-5-16-13-17(33)14-21(24(16)20)15-3-6-18(7-4-15)35(2)34/h3-4,6-7,13,19,21-23H,5,8-12,14H2,1-2H3/t19-,21?,22+,23?,25+,35?/m1/s1 |
| InChIKey | IYIRYQQIWZVDII-BORSEDQKSA-N |
| XLogP | 7.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|