C23H30N2O3 — CID 154334566
benzyl N-[(2S)-3-methyl-1-[methyl(3-phenylpropyl)amino]-1-oxobutan-2-yl]carbamate (PubChem CID 154334566) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is benzyl N-[(2S)-3-methyl-1-[methyl(3-phenylpropyl)amino]-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-3-methyl-1-[methyl(3-phenylpropyl)amino]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 154334566 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | benzyl N-[(2S)-3-methyl-1-[methyl(3-phenylpropyl)amino]-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)N(C)CCCc1ccccc1 |
| InChI | InChI=1S/C23H30N2O3/c1-18(2)21(24-23(27)28-17-20-13-8-5-9-14-20)22(26)25(3)16-10-15-19-11-6-4-7-12-19/h4-9,11-14,18,21H,10,15-17H2,1-3H3,(H,24,27)/t21-/m0/s1 |
| InChIKey | UTHIYIFGBSARII-NRFANRHFSA-N |
| XLogP | 4.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |