About prop-2-enyl-tris(2,4,6-trimethylphenyl)silane
prop-2-enyl-tris(2,4,6-trimethylphenyl)silane (PubChem CID 15433476) has the molecular formula C30H38Si
and a molecular weight of 426.72 g/mol. Its IUPAC name is prop-2-enyl-tris(2,4,6-trimethylphenyl)silane.
Molecular Properties
| Compound Name | prop-2-enyl-tris(2,4,6-trimethylphenyl)silane |
| PubChem CID | 15433476 |
| Molecular Formula | C30H38Si |
| Molecular Weight | 426.72 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | prop-2-enyl-tris(2,4,6-trimethylphenyl)silane |
| SMILES | C=CC[Si](c1c(C)cc(C)cc1C)(c1c(C)cc(C)cc1C)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C30H38Si/c1-11-12-31(28-22(5)13-19(2)14-23(28)6,29-24(7)15-20(3)16-25(29)8)30-26(9)17-21(4)18-27(30)10/h11,13-18H,1,12H2,2-10H3 |
| InChIKey | FUTIHRQUEZTATO-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.72 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl-tris(2,4,6-trimethylphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl-tris(2,4,6-trimethylphenyl)silane?
The IUPAC name of prop-2-enyl-tris(2,4,6-trimethylphenyl)silane (CID 15433476) is prop-2-enyl-tris(2,4,6-trimethylphenyl)silane.
What is the SMILES notation for prop-2-enyl-tris(2,4,6-trimethylphenyl)silane?
The canonical SMILES for prop-2-enyl-tris(2,4,6-trimethylphenyl)silane is C=CC[Si](c1c(C)cc(C)cc1C)(c1c(C)cc(C)cc1C)c1c(C)cc(C)cc1C.
What is the InChIKey of prop-2-enyl-tris(2,4,6-trimethylphenyl)silane?
The InChIKey is FUTIHRQUEZTATO-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H38Si/c1-11-12-31(28-22(5)13-19(2)14-23(28)6,29-24(7)15-20(3)16-25(29)8)30-26(9)17-21(4)18-27(30)10/h11,13-18H,1,12H2,2-10H3.
What are the key properties of prop-2-enyl-tris(2,4,6-trimethylphenyl)silane?
prop-2-enyl-tris(2,4,6-trimethylphenyl)silane has a molecular weight of 426.72 g/mol, XLogP of 6.12, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl-tris(2,4,6-trimethylphenyl)silane is sourced from PubChem (CID 15433476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).