C17H12BrClF3NO2 — CID 154335816
N-(2-benzoyl-5-chlorophenyl)-2-bromo-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 154335816) has the molecular formula C17H12BrClF3NO2 and a molecular weight of 434.64 g/mol. Its IUPAC name is N-(2-benzoyl-5-chlorophenyl)-2-bromo-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | N-(2-benzoyl-5-chlorophenyl)-2-bromo-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 154335816 |
| Molecular Formula | C17H12BrClF3NO2 |
| Molecular Weight | 434.64 g/mol |
| Exact Mass | 432.97 |
| IUPAC Name | N-(2-benzoyl-5-chlorophenyl)-2-bromo-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(c1ccccc1)c1ccc(Cl)cc1N(CC(F)(F)F)C(=O)CBr |
| InChI | InChI=1S/C17H12BrClF3NO2/c18-9-15(24)23(10-17(20,21)22)14-8-12(19)6-7-13(14)16(25)11-4-2-1-3-5-11/h1-8H,9-10H2 |
| InChIKey | FIQNNCYFEUCFCI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.64 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|