C20H26 — CID 154336368
(8R,9S,10R,13S,14S)-13-prop-2-ynyl-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene (PubChem CID 154336368) has the molecular formula C20H26 and a molecular weight of 266.43 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-13-prop-2-ynyl-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene.
| Compound Name | (8R,9S,10R,13S,14S)-13-prop-2-ynyl-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 154336368 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | (8R,9S,10R,13S,14S)-13-prop-2-ynyl-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
| SMILES | C#CC[C@@]12CCC[C@H]1[C@@H]1CC=C3C=CCC[C@@H]3[C@H]1CC2 |
| InChI | InChI=1S/C20H26/c1-2-12-20-13-5-8-19(20)18-10-9-15-6-3-4-7-16(15)17(18)11-14-20/h1,3,6,9,16-19H,4-5,7-8,10-14H2/t16-,17+,18+,19-,20-/m0/s1 |
| InChIKey | PTKXHKCVGZIYLY-MDMHHNQBSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|