About 4-carboxyoxybut-3-enyl 2-methylprop-2-enoate
4-carboxyoxybut-3-enyl 2-methylprop-2-enoate (PubChem CID 154336976) has the molecular formula C9H12O5
and a molecular weight of 200.19 g/mol. Its IUPAC name is 4-carboxyoxybut-3-enyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 4-carboxyoxybut-3-enyl 2-methylprop-2-enoate |
| PubChem CID | 154336976 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 4-carboxyoxybut-3-enyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC=COC(=O)O |
| InChI | InChI=1S/C9H12O5/c1-7(2)8(10)13-5-3-4-6-14-9(11)12/h4,6H,1,3,5H2,2H3,(H,11,12) |
| InChIKey | OVTLUDLKKUSJCU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-carboxyoxybut-3-enyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-carboxyoxybut-3-enyl 2-methylprop-2-enoate?
The IUPAC name of 4-carboxyoxybut-3-enyl 2-methylprop-2-enoate (CID 154336976) is 4-carboxyoxybut-3-enyl 2-methylprop-2-enoate.
What is the SMILES notation for 4-carboxyoxybut-3-enyl 2-methylprop-2-enoate?
The canonical SMILES for 4-carboxyoxybut-3-enyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCC=COC(=O)O.
What is the InChIKey of 4-carboxyoxybut-3-enyl 2-methylprop-2-enoate?
The InChIKey is OVTLUDLKKUSJCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O5/c1-7(2)8(10)13-5-3-4-6-14-9(11)12/h4,6H,1,3,5H2,2H3,(H,11,12).
What are the key properties of 4-carboxyoxybut-3-enyl 2-methylprop-2-enoate?
4-carboxyoxybut-3-enyl 2-methylprop-2-enoate has a molecular weight of 200.19 g/mol, XLogP of 1.70, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-carboxyoxybut-3-enyl 2-methylprop-2-enoate is sourced from PubChem (CID 154336976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).