C24H31F3N4O2 — CID 154337394
4-methyl-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-5-(3,4,4-trifluorobut-3-enyl)-1H-pyrimidin-6-one (PubChem CID 154337394) has the molecular formula C24H31F3N4O2 and a molecular weight of 464.53 g/mol. Its IUPAC name is 4-methyl-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-5-(3,4,4-trifluorobut-3-enyl)-1H-pyrimidin-6-one.
| Compound Name | 4-methyl-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-5-(3,4,4-trifluorobut-3-enyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 154337394 |
| Molecular Formula | C24H31F3N4O2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 4-methyl-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-5-(3,4,4-trifluorobut-3-enyl)-1H-pyrimidin-6-one |
| SMILES | Cc1nc(NCCCOc2cccc(CN3CCCCC3)c2)[nH]c(=O)c1CCC(F)=C(F)F |
| InChI | InChI=1S/C24H31F3N4O2/c1-17-20(9-10-21(25)22(26)27)23(32)30-24(29-17)28-11-6-14-33-19-8-5-7-18(15-19)16-31-12-3-2-4-13-31/h5,7-8,15H,2-4,6,9-14,16H2,1H3,(H2,28,29,30,32) |
| InChIKey | MLBMEAWBEHTZHE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|