C11H21N5 — CID 154337652
4-[(1-methylpiperidin-4-yl)methyl]-1H-pyrimidine-2,4-diamine (PubChem CID 154337652) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is 4-[(1-methylpiperidin-4-yl)methyl]-1H-pyrimidine-2,4-diamine.
| Compound Name | 4-[(1-methylpiperidin-4-yl)methyl]-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 154337652 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | 4-[(1-methylpiperidin-4-yl)methyl]-1H-pyrimidine-2,4-diamine |
| SMILES | CN1CCC(CC2(N)C=CNC(N)=N2)CC1 |
| InChI | InChI=1S/C11H21N5/c1-16-6-2-9(3-7-16)8-11(13)4-5-14-10(12)15-11/h4-5,9H,2-3,6-8,13H2,1H3,(H3,12,14,15) |
| InChIKey | ZIJKNWPHFXAHRW-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |