C28H38N4O — CID 154338396
N-[1-[4-phenyl-4-(phenylhydrazinylidene)butyl]piperidin-4-yl]cyclohexanecarboxamide (PubChem CID 154338396) has the molecular formula C28H38N4O and a molecular weight of 446.64 g/mol. Its IUPAC name is N-[1-[4-phenyl-4-(phenylhydrazinylidene)butyl]piperidin-4-yl]cyclohexanecarboxamide.
| Compound Name | N-[1-[4-phenyl-4-(phenylhydrazinylidene)butyl]piperidin-4-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 154338396 |
| Molecular Formula | C28H38N4O |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | N-[1-[4-phenyl-4-(phenylhydrazinylidene)butyl]piperidin-4-yl]cyclohexanecarboxamide |
| SMILES | O=C(NC1CCN(CCCC(=NNc2ccccc2)c2ccccc2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C28H38N4O/c33-28(24-13-6-2-7-14-24)29-25-18-21-32(22-19-25)20-10-17-27(23-11-4-1-5-12-23)31-30-26-15-8-3-9-16-26/h1,3-5,8-9,11-12,15-16,24-25,30H,2,6-7,10,13-14,17-22H2,(H,29,33) |
| InChIKey | ARGPVWPKHWTQKI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|