About 1H-perimidine-4,6-diol
1H-perimidine-4,6-diol (PubChem CID 154338684) has the molecular formula C11H8N2O2
and a molecular weight of 200.20 g/mol. Its IUPAC name is 1H-perimidine-4,6-diol.
Molecular Properties
| Compound Name | 1H-perimidine-4,6-diol |
| PubChem CID | 154338684 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 1H-perimidine-4,6-diol |
| SMILES | Oc1cc(O)c2cccc3c2c1N=CN3 |
| InChI | InChI=1S/C11H8N2O2/c14-8-4-9(15)11-10-6(8)2-1-3-7(10)12-5-13-11/h1-5,14-15H,(H,12,13) |
| InChIKey | WRROVDSQNQEADR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'} |
|---|
Analyze 1H-perimidine-4,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-perimidine-4,6-diol?
The IUPAC name of 1H-perimidine-4,6-diol (CID 154338684) is 1H-perimidine-4,6-diol.
What is the SMILES notation for 1H-perimidine-4,6-diol?
The canonical SMILES for 1H-perimidine-4,6-diol is Oc1cc(O)c2cccc3c2c1N=CN3.
What is the InChIKey of 1H-perimidine-4,6-diol?
The InChIKey is WRROVDSQNQEADR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O2/c14-8-4-9(15)11-10-6(8)2-1-3-7(10)12-5-13-11/h1-5,14-15H,(H,12,13).
What are the key properties of 1H-perimidine-4,6-diol?
1H-perimidine-4,6-diol has a molecular weight of 200.20 g/mol, XLogP of 2.34, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-perimidine-4,6-diol is sourced from PubChem (CID 154338684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).