C11H8N2O2 — CID 154338684
1H-perimidine-4,6-diol (PubChem CID 154338684) has the molecular formula C11H8N2O2 and a molecular weight of 200.20 g/mol. Its IUPAC name is 1H-perimidine-4,6-diol.
| Compound Name | 1H-perimidine-4,6-diol |
|---|---|
| PubChem CID | 154338684 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 1H-perimidine-4,6-diol |
| SMILES | Oc1cc(O)c2cccc3c2c1N=CN3 |
| InChI | InChI=1S/C11H8N2O2/c14-8-4-9(15)11-10-6(8)2-1-3-7(10)12-5-13-11/h1-5,14-15H,(H,12,13) |
| InChIKey | WRROVDSQNQEADR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'} |
|---|