C48H68N2O12+2 — CID 15434195
bis[(1S,5R)-8-[(3,5-dimethoxy-4-propanoyloxyphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] cyclohexane-1,3-dicarboxylate (PubChem CID 15434195) has the molecular formula C48H68N2O12+2 and a molecular weight of 865.07 g/mol. Its IUPAC name is bis[(1S,5R)-8-[(3,5-dimethoxy-4-propanoyloxyphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] cyclohexane-1,3-dicarboxylate.
| Compound Name | bis[(1S,5R)-8-[(3,5-dimethoxy-4-propanoyloxyphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] cyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 15434195 |
| Molecular Formula | C48H68N2O12+2 |
| Molecular Weight | 865.07 g/mol |
| Exact Mass | 864.48 |
| IUPAC Name | bis[(1S,5R)-8-[(3,5-dimethoxy-4-propanoyloxyphenyl)methyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] cyclohexane-1,3-dicarboxylate |
| SMILES | CCC(=O)Oc1c(OC)cc(C[N+]2(C)[C@@H]3CC[C@H]2CC(OC(=O)C2CCCC(C(=O)OC4C[C@H]5CC[C@@H](C4)[N+]5(C)Cc4cc(OC)c(OC(=O)CC)c(OC)c4)C2)C3)cc1OC |
| InChI | InChI=1S/C48H68N2O12/c1-9-43(51)61-45-39(55-5)18-29(19-40(45)56-6)27-49(3)33-14-15-34(49)24-37(23-33)59-47(53)31-12-11-13-32(22-31)48(54)60-38-25-35-16-17-36(26-38)50(35,4)28-30-20-41(57-7)46(42(21-30)58-8)62-44(52)10-2/h18-21,31-38H,9-17,22-28H2,1-8H3/q+2/t31?,32?,33-,34+,35-,36+,37?,38?,49?,50? |
| InChIKey | CGYNJIDBNJQYQS-WYOPKYSUSA-N |
| XLogP | 7.22 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.07 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|